-
Myristoleic acid, or 9-tetradecenoic acid, is an omega-5
fatty acid. It is
biosynthesized from
myristic acid by the
enzyme Stearoyl-CoA desaturase-1,...
-
point 180–181 °C,
specific gravity 1.027. CAS
registry number 107-93-7.
Myristoleic acid has 14 carbons, is
found in
whale blubber, and is a cis-9-monounsaturated...
- specifically, a
cetylated fatty acid (CFA). It is the
cetyl ester of
myristoleic acid.
Preclinical and
clinical data show
potential benefits in the management...
-
Examples of
unsaturated fatty acids are
palmitoleic acid,
oleic acid,
myristoleic acid,
linoleic acid, and
arachidonic acid.
Foods containing unsaturated...
- CH3(CH2)7CH=CH(CH2)11COOH cis-Δ13 22:1 22:1(13) n−9 Omega−5, 7, and 10:
Myristoleic acid CH3(CH2)3CH=CH(CH2)7COOH cis-Δ9 14:1 14:1(9) n−5
Palmitoleic acid...
- acid (C20)
Behenic acid (C22)
Lignoceric acid (C24)
Cerotic acid (C26)
Myristoleic acid
Oleic acid
Eicosenoic acids Erucic acid
Nervonic acid
Linoleic acid...
- alpha-linolenic acid,
linoleic acid,
palmitoleic acid,
oleic acid, and
myristoleic acid.
Medium chain fatty acids such as
those found in
coconut and the...
- (18:0) 3.3%
Myristic acid (14:0) 1.1%
Docosahexaenoic acid (22:6) 0.5%
Myristoleic acid (14:1) 0.4%
Heptadecanoic acid (17:0) 0.3%
Arachidonic acid (20:4)...
-
Fatty acids Compound name
Chemical structure Myristoleic acid
Myristic acid
Palmitic acid
Linoleic acid
Linolenic acid
Oleic acid
Stearic acid Nonadecylic...
- γ-linolenic acid (12.23%),
linoleic acid (4.95%),
elaidic acid (2.50%), and
myristoleic acid (1.89%). The fruit's pulp is
typically eaten raw and has the fragrance...
